About (2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine
(2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine (PubChem CID 67575468) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is (2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine.
Molecular Properties
| Compound Name | (2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine |
| PubChem CID | 67575468 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine |
| SMILES | COC[C@H]1NCCO[C@@H]1C1C=CC=CC1 |
| InChI | InChI=1S/C12H19NO2/c1-14-9-11-12(15-8-7-13-11)10-5-3-2-4-6-10/h2-5,10-13H,6-9H2,1H3/t10?,11-,12-/m1/s1 |
| InChIKey | YJWCRYLPGVYYJI-PQDIPPBSSA-N |
| XLogP | 1.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine?
The IUPAC name of (2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine (CID 67575468) is (2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine.
What is the SMILES notation for (2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine?
The canonical SMILES for (2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine is COC[C@H]1NCCO[C@@H]1C1C=CC=CC1.
What is the InChIKey of (2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine?
The InChIKey is YJWCRYLPGVYYJI-PQDIPPBSSA-N. The full InChI is InChI=1S/C12H19NO2/c1-14-9-11-12(15-8-7-13-11)10-5-3-2-4-6-10/h2-5,10-13H,6-9H2,1H3/t10?,11-,12-/m1/s1.
What are the key properties of (2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine?
(2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine has a molecular weight of 209.29 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2-cyclohexa-2,4-dien-1-yl-3-(methoxymethyl)morpholine is sourced from PubChem (CID 67575468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).