About [(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate
[(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate (PubChem CID 67576063) has the molecular formula C18H27ClN2O5S
and a molecular weight of 418.94 g/mol. Its IUPAC name is [(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate.
Molecular Properties
| Compound Name | [(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate |
| PubChem CID | 67576063 |
| Molecular Formula | C18H27ClN2O5S |
| Molecular Weight | 418.94 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1OCC[C@@H]1NC[C@@H](CC(C)C)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H27ClN2O5S/c1-12(2)10-15(11-20-17-8-9-25-18(17)26-13(3)22)21-27(23,24)16-6-4-14(19)5-7-16/h4-7,12,15,17-18,20-21H,8-11H2,1-3H3/t15-,17+,18+/m1/s1 |
| InChIKey | XMUAVOBGHIAXBG-NJAFHUGGSA-N |
| XLogP | 2.30 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.94 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate?
The IUPAC name of [(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate (CID 67576063) is [(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate.
What is the SMILES notation for [(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate?
The canonical SMILES for [(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate is CC(=O)O[C@@H]1OCC[C@@H]1NC[C@@H](CC(C)C)NS(=O)(=O)c1ccc(Cl)cc1.
What is the InChIKey of [(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate?
The InChIKey is XMUAVOBGHIAXBG-NJAFHUGGSA-N. The full InChI is InChI=1S/C18H27ClN2O5S/c1-12(2)10-15(11-20-17-8-9-25-18(17)26-13(3)22)21-27(23,24)16-6-4-14(19)5-7-16/h4-7,12,15,17-18,20-21H,8-11H2,1-3H3/t15-,17+,18+/m1/s1.
What are the key properties of [(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate?
[(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate has a molecular weight of 418.94 g/mol, XLogP of 2.30, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-3-[[(2R)-2-[(4-chlorophenyl)sulfonylamino]-4-methylpentyl]amino]oxolan-2-yl] acetate is sourced from PubChem (CID 67576063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).