C14H16BNO2 — CID 67576470
2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-7-methyl-1H-indole (PubChem CID 67576470) has the molecular formula C14H16BNO2 and a molecular weight of 241.10 g/mol. Its IUPAC name is 2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-7-methyl-1H-indole.
| Compound Name | 2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-7-methyl-1H-indole |
|---|---|
| PubChem CID | 67576470 |
| Molecular Formula | C14H16BNO2 |
| Molecular Weight | 241.10 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-7-methyl-1H-indole |
| SMILES | C=C1OB(c2cc3cccc(C)c3[nH]2)OC1(C)C |
| InChI | InChI=1S/C14H16BNO2/c1-9-6-5-7-11-8-12(16-13(9)11)15-17-10(2)14(3,4)18-15/h5-8,16H,2H2,1,3-4H3 |
| InChIKey | ZBURFJHFALUEEQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.10 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|