C31H52F2O7 — CID 67577197
propan-2-yl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-(4,4-difluoro-7-methyl-3-oxooctyl)-3-(oxan-2-yloxy)cyclopentyl]heptanoate (PubChem CID 67577197) has the molecular formula C31H52F2O7 and a molecular weight of 574.75 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-(4,4-difluoro-7-methyl-3-oxooctyl)-3-(oxan-2-yloxy)cyclopentyl]heptanoate.
| Compound Name | propan-2-yl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-(4,4-difluoro-7-methyl-3-oxooctyl)-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 67577197 |
| Molecular Formula | C31H52F2O7 |
| Molecular Weight | 574.75 g/mol |
| Exact Mass | 574.37 |
| IUPAC Name | propan-2-yl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-(4,4-difluoro-7-methyl-3-oxooctyl)-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
| SMILES | CC(=O)O[C@H]1C[C@@H](OC2CCCCO2)[C@H](CCC(=O)C(F)(F)CCC(C)C)[C@H]1CCCCCCC(=O)OC(C)C |
| InChI | InChI=1S/C31H52F2O7/c1-21(2)17-18-31(32,33)28(35)16-15-25-24(12-8-6-7-9-13-29(36)38-22(3)4)26(39-23(5)34)20-27(25)40-30-14-10-11-19-37-30/h21-22,24-27,30H,6-20H2,1-5H3/t24-,25-,26+,27-,30?/m1/s1 |
| InChIKey | GPKAISRGILPRHG-XEVAOIDQSA-N |
| XLogP | 7.18 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.75 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|