C29H48F2O7 — CID 67577203
methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(5R)-4,4-difluoro-5-methyl-3-oxooctyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate (PubChem CID 67577203) has the molecular formula C29H48F2O7 and a molecular weight of 546.69 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(5R)-4,4-difluoro-5-methyl-3-oxooctyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(5R)-4,4-difluoro-5-methyl-3-oxooctyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 67577203 |
| Molecular Formula | C29H48F2O7 |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-5-acetyloxy-2-[(5R)-4,4-difluoro-5-methyl-3-oxooctyl]-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
| SMILES | CCC[C@@H](C)C(F)(F)C(=O)CC[C@@H]1[C@@H](CCCCCCC(=O)OC)[C@@H](OC(C)=O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C29H48F2O7/c1-5-12-20(2)29(30,31)26(33)17-16-23-22(13-8-6-7-9-14-27(34)35-4)24(37-21(3)32)19-25(23)38-28-15-10-11-18-36-28/h20,22-25,28H,5-19H2,1-4H3/t20-,22-,23-,24+,25-,28?/m1/s1 |
| InChIKey | IMRVQXJVSZMMME-PFADFTSISA-N |
| XLogP | 6.40 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|