C17H24F2O3 — CID 67577213
(3aR,4R,6aS)-4-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 67577213) has the molecular formula C17H24F2O3 and a molecular weight of 314.37 g/mol. Its IUPAC name is (3aR,4R,6aS)-4-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,6aS)-4-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 67577213 |
| Molecular Formula | C17H24F2O3 |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (3aR,4R,6aS)-4-[(5R)-4,4-difluoro-5,7-dimethyl-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)C[C@@H](C)C(F)(F)C(=O)C=C[C@H]1CC[C@@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H24F2O3/c1-10(2)8-11(3)17(18,19)15(20)7-5-12-4-6-14-13(12)9-16(21)22-14/h5,7,10-14H,4,6,8-9H2,1-3H3/t11-,12-,13-,14+/m1/s1 |
| InChIKey | GEARAIDNZSJWBM-SYQHCUMBSA-N |
| XLogP | 3.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|