C17H16F4O — CID 67577392
1-(4,4-difluorobutyl)-3-[4-(difluoromethoxy)phenyl]benzene (PubChem CID 67577392) has the molecular formula C17H16F4O and a molecular weight of 312.31 g/mol. Its IUPAC name is 1-(4,4-difluorobutyl)-3-[4-(difluoromethoxy)phenyl]benzene.
| Compound Name | 1-(4,4-difluorobutyl)-3-[4-(difluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 67577392 |
| Molecular Formula | C17H16F4O |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-(4,4-difluorobutyl)-3-[4-(difluoromethoxy)phenyl]benzene |
| SMILES | FC(F)CCCc1cccc(-c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C17H16F4O/c18-16(19)6-2-4-12-3-1-5-14(11-12)13-7-9-15(10-8-13)22-17(20)21/h1,3,5,7-11,16-17H,2,4,6H2 |
| InChIKey | IHMVUOZQDSIRGW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |