C20H22ClN3O2S — CID 67577428
N-[4-(2-methylimidazol-1-yl)phenyl]-2-thiophen-2-yloxane-4-carboxamide;hydrochloride (PubChem CID 67577428) has the molecular formula C20H22ClN3O2S and a molecular weight of 403.94 g/mol. Its IUPAC name is N-[4-(2-methylimidazol-1-yl)phenyl]-2-thiophen-2-yloxane-4-carboxamide;hydrochloride.
| Compound Name | N-[4-(2-methylimidazol-1-yl)phenyl]-2-thiophen-2-yloxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67577428 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-[4-(2-methylimidazol-1-yl)phenyl]-2-thiophen-2-yloxane-4-carboxamide;hydrochloride |
| SMILES | Cc1nccn1-c1ccc(NC(=O)C2CCOC(c3cccs3)C2)cc1.Cl |
| InChI | InChI=1S/C20H21N3O2S.ClH/c1-14-21-9-10-23(14)17-6-4-16(5-7-17)22-20(24)15-8-11-25-18(13-15)19-3-2-12-26-19;/h2-7,9-10,12,15,18H,8,11,13H2,1H3,(H,22,24);1H |
| InChIKey | CBBNEZYZOGDHSW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |