C15H18BNO3 — CID 67577498
2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-4-methoxy-1-methylindole (PubChem CID 67577498) has the molecular formula C15H18BNO3 and a molecular weight of 271.12 g/mol. Its IUPAC name is 2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-4-methoxy-1-methylindole.
| Compound Name | 2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-4-methoxy-1-methylindole |
|---|---|
| PubChem CID | 67577498 |
| Molecular Formula | C15H18BNO3 |
| Molecular Weight | 271.12 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-(4,4-dimethyl-5-methylidene-1,3,2-dioxaborolan-2-yl)-4-methoxy-1-methylindole |
| SMILES | C=C1OB(c2cc3c(OC)cccc3n2C)OC1(C)C |
| InChI | InChI=1S/C15H18BNO3/c1-10-15(2,3)20-16(19-10)14-9-11-12(17(14)4)7-6-8-13(11)18-5/h6-9H,1H2,2-5H3 |
| InChIKey | FAKKSENZARWYCD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.12 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|