C17H17Cl2N5O5 — CID 67577572
1-[4-amino-6-(2,5-dichlorophenyl)-1,3,5-triazin-2-yl]pyrrolidin-3-ol;but-2-enedioic acid (PubChem CID 67577572) has the molecular formula C17H17Cl2N5O5 and a molecular weight of 442.26 g/mol. Its IUPAC name is 1-[4-amino-6-(2,5-dichlorophenyl)-1,3,5-triazin-2-yl]pyrrolidin-3-ol;but-2-enedioic acid.
| Compound Name | 1-[4-amino-6-(2,5-dichlorophenyl)-1,3,5-triazin-2-yl]pyrrolidin-3-ol;but-2-enedioic acid |
|---|---|
| PubChem CID | 67577572 |
| Molecular Formula | C17H17Cl2N5O5 |
| Molecular Weight | 442.26 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 1-[4-amino-6-(2,5-dichlorophenyl)-1,3,5-triazin-2-yl]pyrrolidin-3-ol;but-2-enedioic acid |
| SMILES | Nc1nc(-c2cc(Cl)ccc2Cl)nc(N2CCC(O)C2)n1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C13H13Cl2N5O.C4H4O4/c14-7-1-2-10(15)9(5-7)11-17-12(16)19-13(18-11)20-4-3-8(21)6-20;5-3(6)1-2-4(7)8/h1-2,5,8,21H,3-4,6H2,(H2,16,17,18,19);1-2H,(H,5,6)(H,7,8) |
| InChIKey | ZNYODWATRJGRHC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 162.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|