About tetra(cyclopenta-1,3-dien-1-yl)stannane
tetra(cyclopenta-1,3-dien-1-yl)stannane (PubChem CID 67577909) has the molecular formula C20H20Sn
and a molecular weight of 379.09 g/mol. Its IUPAC name is tetra(cyclopenta-1,3-dien-1-yl)stannane.
Molecular Properties
| Compound Name | tetra(cyclopenta-1,3-dien-1-yl)stannane |
| PubChem CID | 67577909 |
| Molecular Formula | C20H20Sn |
| Molecular Weight | 379.09 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | tetra(cyclopenta-1,3-dien-1-yl)stannane |
| SMILES | C1=CCC([Sn](C2=CC=CC2)(C2=CC=CC2)C2=CC=CC2)=C1 |
| InChI | InChI=1S/4C5H5.Sn/c4*1-2-4-5-3-1;/h4*1-3H,4H2; |
| InChIKey | ACKDIXBHZHEPTI-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.09 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tetra(cyclopenta-1,3-dien-1-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetra(cyclopenta-1,3-dien-1-yl)stannane?
The IUPAC name of tetra(cyclopenta-1,3-dien-1-yl)stannane (CID 67577909) is tetra(cyclopenta-1,3-dien-1-yl)stannane.
What is the SMILES notation for tetra(cyclopenta-1,3-dien-1-yl)stannane?
The canonical SMILES for tetra(cyclopenta-1,3-dien-1-yl)stannane is C1=CCC([Sn](C2=CC=CC2)(C2=CC=CC2)C2=CC=CC2)=C1.
What is the InChIKey of tetra(cyclopenta-1,3-dien-1-yl)stannane?
The InChIKey is ACKDIXBHZHEPTI-UHFFFAOYSA-N. The full InChI is InChI=1S/4C5H5.Sn/c4*1-2-4-5-3-1;/h4*1-3H,4H2;.
What are the key properties of tetra(cyclopenta-1,3-dien-1-yl)stannane?
tetra(cyclopenta-1,3-dien-1-yl)stannane has a molecular weight of 379.09 g/mol, XLogP of 5.14, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetra(cyclopenta-1,3-dien-1-yl)stannane is sourced from PubChem (CID 67577909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).