C17H26F2O3 — CID 67578177
(3aR,4R,6aS)-4-(5,5-difluoro-2-methyl-6-oxononan-4-yl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 67578177) has the molecular formula C17H26F2O3 and a molecular weight of 316.39 g/mol. Its IUPAC name is (3aR,4R,6aS)-4-(5,5-difluoro-2-methyl-6-oxononan-4-yl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,6aS)-4-(5,5-difluoro-2-methyl-6-oxononan-4-yl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 67578177 |
| Molecular Formula | C17H26F2O3 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (3aR,4R,6aS)-4-(5,5-difluoro-2-methyl-6-oxononan-4-yl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCC(=O)C(F)(F)C(CC(C)C)[C@@H]1CC[C@@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H26F2O3/c1-4-5-15(20)17(18,19)13(8-10(2)3)11-6-7-14-12(11)9-16(21)22-14/h10-14H,4-9H2,1-3H3/t11-,12-,13?,14+/m1/s1 |
| InChIKey | UJBANDHEVWKQMC-VMXNZORSSA-N |
| XLogP | 3.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |