C22H38F2O4 — CID 67578297
(Z)-7-[(1R,2R,5S)-2-(5,5-difluoro-6-hydroxy-2-methylnonan-4-yl)-5-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 67578297) has the molecular formula C22H38F2O4 and a molecular weight of 404.54 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-2-(5,5-difluoro-6-hydroxy-2-methylnonan-4-yl)-5-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-2-(5,5-difluoro-6-hydroxy-2-methylnonan-4-yl)-5-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67578297 |
| Molecular Formula | C22H38F2O4 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-2-(5,5-difluoro-6-hydroxy-2-methylnonan-4-yl)-5-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | CCCC(O)C(F)(F)C(CC(C)C)[C@@H]1CC[C@H](O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C22H38F2O4/c1-4-9-20(26)22(23,24)18(14-15(2)3)16-12-13-19(25)17(16)10-7-5-6-8-11-21(27)28/h5,7,15-20,25-26H,4,6,8-14H2,1-3H3,(H,27,28)/b7-5-/t16-,17-,18?,19+,20?/m1/s1 |
| InChIKey | ODVOJEPJMAVLJW-AYWZVWONSA-N |
| XLogP | 5.03 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|