C25H38N3O10P — CID 67579277
2-carbamoyl-3-[1-(carbamoylamino)-4-cyclohexylbutyl]-2-methyl-3-[(4-phosphonooxyphenyl)methyl]pentanedioic acid (PubChem CID 67579277) has the molecular formula C25H38N3O10P and a molecular weight of 571.56 g/mol. Its IUPAC name is 2-carbamoyl-3-[1-(carbamoylamino)-4-cyclohexylbutyl]-2-methyl-3-[(4-phosphonooxyphenyl)methyl]pentanedioic acid.
| Compound Name | 2-carbamoyl-3-[1-(carbamoylamino)-4-cyclohexylbutyl]-2-methyl-3-[(4-phosphonooxyphenyl)methyl]pentanedioic acid |
|---|---|
| PubChem CID | 67579277 |
| Molecular Formula | C25H38N3O10P |
| Molecular Weight | 571.56 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | 2-carbamoyl-3-[1-(carbamoylamino)-4-cyclohexylbutyl]-2-methyl-3-[(4-phosphonooxyphenyl)methyl]pentanedioic acid |
| SMILES | CC(C(N)=O)(C(=O)O)C(CC(=O)O)(Cc1ccc(OP(=O)(O)O)cc1)C(CCCC1CCCCC1)NC(N)=O |
| InChI | InChI=1S/C25H38N3O10P/c1-24(21(26)31,22(32)33)25(15-20(29)30,14-17-10-12-18(13-11-17)38-39(35,36)37)19(28-23(27)34)9-5-8-16-6-3-2-4-7-16/h10-13,16,19H,2-9,14-15H2,1H3,(H2,26,31)(H,29,30)(H,32,33)(H3,27,28,34)(H2,35,36,37) |
| InChIKey | WJHGUAJYAKSHFK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 239.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.56 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|