C21H25F4NO4S2 — CID 67579333
methyl 4-[5-[6,6,6-trifluoro-1-[(4-fluorophenyl)sulfonylamino]hexyl]thiophen-2-yl]butanoate (PubChem CID 67579333) has the molecular formula C21H25F4NO4S2 and a molecular weight of 495.56 g/mol. Its IUPAC name is methyl 4-[5-[6,6,6-trifluoro-1-[(4-fluorophenyl)sulfonylamino]hexyl]thiophen-2-yl]butanoate.
| Compound Name | methyl 4-[5-[6,6,6-trifluoro-1-[(4-fluorophenyl)sulfonylamino]hexyl]thiophen-2-yl]butanoate |
|---|---|
| PubChem CID | 67579333 |
| Molecular Formula | C21H25F4NO4S2 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | methyl 4-[5-[6,6,6-trifluoro-1-[(4-fluorophenyl)sulfonylamino]hexyl]thiophen-2-yl]butanoate |
| SMILES | COC(=O)CCCc1ccc(C(CCCCC(F)(F)F)NS(=O)(=O)c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C21H25F4NO4S2/c1-30-20(27)7-4-5-16-10-13-19(31-16)18(6-2-3-14-21(23,24)25)26-32(28,29)17-11-8-15(22)9-12-17/h8-13,18,26H,2-7,14H2,1H3 |
| InChIKey | IEQQYWBQZUSSEG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|