C30H52N4O6 — CID 67579440
2-amino-5-[[amino-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]methylidene]amino]pentanoic acid (PubChem CID 67579440) has the molecular formula C30H52N4O6 and a molecular weight of 564.77 g/mol. Its IUPAC name is 2-amino-5-[[amino-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]methylidene]amino]pentanoic acid.
| Compound Name | 2-amino-5-[[amino-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]methylidene]amino]pentanoic acid |
|---|---|
| PubChem CID | 67579440 |
| Molecular Formula | C30H52N4O6 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.39 |
| IUPAC Name | 2-amino-5-[[amino-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]methylidene]amino]pentanoic acid |
| SMILES | CC(CCC(=O)N/C(N)=N/CCCC(N)C(=O)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| InChI | InChI=1S/C30H52N4O6/c1-16(6-9-25(38)34-28(32)33-12-4-5-22(31)27(39)40)19-7-8-20-26-21(15-24(37)30(19,20)3)29(2)11-10-18(35)13-17(29)14-23(26)36/h16-24,26,35-37H,4-15,31H2,1-3H3,(H,39,40)(H3,32,33,34,38) |
| InChIKey | CXNINZGUVHRCMH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 191.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|