C16H17N3O2 — CID 67579634
2-ethyl-5-methoxy-9-methyl-4,9,15-triazatricyclo[9.4.0.03,8]pentadeca-1(11),2,4,6,12,14-hexaen-10-one (PubChem CID 67579634) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-ethyl-5-methoxy-9-methyl-4,9,15-triazatricyclo[9.4.0.03,8]pentadeca-1(11),2,4,6,12,14-hexaen-10-one.
| Compound Name | 2-ethyl-5-methoxy-9-methyl-4,9,15-triazatricyclo[9.4.0.03,8]pentadeca-1(11),2,4,6,12,14-hexaen-10-one |
|---|---|
| PubChem CID | 67579634 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-ethyl-5-methoxy-9-methyl-4,9,15-triazatricyclo[9.4.0.03,8]pentadeca-1(11),2,4,6,12,14-hexaen-10-one |
| SMILES | CCC1=C2N=C(OC)C=CC2N(C)C(=O)c2cccnc21 |
| InChI | InChI=1S/C16H17N3O2/c1-4-10-14-11(6-5-9-17-14)16(20)19(2)12-7-8-13(21-3)18-15(10)12/h5-9,12H,4H2,1-3H3 |
| InChIKey | PVGCFMVUNLPZIJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |