C14H21N — CID 67579668
(2R)-2-methyl-4-(2,2,3-trimethylcyclopent-3-en-1-yl)pent-4-enenitrile (PubChem CID 67579668) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (2R)-2-methyl-4-(2,2,3-trimethylcyclopent-3-en-1-yl)pent-4-enenitrile.
| Compound Name | (2R)-2-methyl-4-(2,2,3-trimethylcyclopent-3-en-1-yl)pent-4-enenitrile |
|---|---|
| PubChem CID | 67579668 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (2R)-2-methyl-4-(2,2,3-trimethylcyclopent-3-en-1-yl)pent-4-enenitrile |
| SMILES | C=C(C[C@@H](C)C#N)C1CC=C(C)C1(C)C |
| InChI | InChI=1S/C14H21N/c1-10(9-15)8-11(2)13-7-6-12(3)14(13,4)5/h6,10,13H,2,7-8H2,1,3-5H3/t10-,13?/m1/s1 |
| InChIKey | PEWYITOSBDCGGN-VUUHIHSGSA-N |
| XLogP | 4.08 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|