C22H25F3N2O6S — CID 67579794
4-[4-[6,6,6-trifluoro-1-[(4-nitrophenyl)sulfonylamino]hexyl]phenyl]butanoic acid (PubChem CID 67579794) has the molecular formula C22H25F3N2O6S and a molecular weight of 502.51 g/mol. Its IUPAC name is 4-[4-[6,6,6-trifluoro-1-[(4-nitrophenyl)sulfonylamino]hexyl]phenyl]butanoic acid.
| Compound Name | 4-[4-[6,6,6-trifluoro-1-[(4-nitrophenyl)sulfonylamino]hexyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 67579794 |
| Molecular Formula | C22H25F3N2O6S |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | 4-[4-[6,6,6-trifluoro-1-[(4-nitrophenyl)sulfonylamino]hexyl]phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(C(CCCCC(F)(F)F)NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H25F3N2O6S/c23-22(24,25)15-2-1-5-20(17-9-7-16(8-10-17)4-3-6-21(28)29)26-34(32,33)19-13-11-18(12-14-19)27(30)31/h7-14,20,26H,1-6,15H2,(H,28,29) |
| InChIKey | IHZYOABJSRZIOP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|