6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid

C13H11IO2 — CID 67579930

IUPAC6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1C=CC=CC1(I)c1ccccc1
InChIInChI=1S/C13H11IO2/c14-13(10-6-2-1-3-7-10)9-5-4-8-11(13)12(15)16/h1-9,11H,(H,15,16)
InChIKeyFQAKLDZRYIHKRV-UHFFFAOYSA-N
MW326.13 g/mol
LogP3.14
Rot. Bonds2

About 6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid

6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 67579930) has the molecular formula C13H11IO2 and a molecular weight of 326.13 g/mol. Its IUPAC name is 6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid
PubChem CID67579930
Molecular FormulaC13H11IO2
Molecular Weight326.13 g/mol
Exact Mass325.98
IUPAC Name6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1C=CC=CC1(I)c1ccccc1
InChIInChI=1S/C13H11IO2/c14-13(10-6-2-1-3-7-10)9-5-4-8-11(13)12(15)16/h1-9,11H,(H,15,16)
InChIKeyFQAKLDZRYIHKRV-UHFFFAOYSA-N
XLogP3.14
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.13
LogP ≤ 53.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid (CID 67579930) is 6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1C=CC=CC1(I)c1ccccc1.
What is the InChIKey of 6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is FQAKLDZRYIHKRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11IO2/c14-13(10-6-2-1-3-7-10)9-5-4-8-11(13)12(15)16/h1-9,11H,(H,15,16).
What are the key properties of 6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid?
6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 326.13 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-6-phenylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 67579930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).