C25H42ClNO6 — CID 67580181
[(3R,4aR,6aS,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-8-yl] 3-(dimethylamino)propanoate;hydrochloride (PubChem CID 67580181) has the molecular formula C25H42ClNO6 and a molecular weight of 488.07 g/mol. Its IUPAC name is [(3R,4aR,6aS,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-8-yl] 3-(dimethylamino)propanoate;hydrochloride.
| Compound Name | [(3R,4aR,6aS,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-8-yl] 3-(dimethylamino)propanoate;hydrochloride |
|---|---|
| PubChem CID | 67580181 |
| Molecular Formula | C25H42ClNO6 |
| Molecular Weight | 488.07 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | [(3R,4aR,6aS,10aR,10bS)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-5,6,6a,8,9,10-hexahydro-2H-benzo[f]chromen-8-yl] 3-(dimethylamino)propanoate;hydrochloride |
| SMILES | C=C[C@@]1(C)CC(=O)[C@@]2(O)[C@@](C)(CC[C@H]3C(C)(C)C(OC(=O)CCN(C)C)CC(O)[C@@]32C)O1.Cl |
| InChI | InChI=1S/C25H41NO6.ClH/c1-9-22(4)15-18(28)25(30)23(5,32-22)12-10-16-21(2,3)19(14-17(27)24(16,25)6)31-20(29)11-13-26(7)8;/h9,16-17,19,27,30H,1,10-15H2,2-8H3;1H/t16-,17?,19?,22-,23+,24+,25+;/m0./s1 |
| InChIKey | SBKOROVZDLQROP-JADJTCTISA-N |
| XLogP | 2.90 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.07 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|