About (2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol
(2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol (PubChem CID 67580271) has the molecular formula C20H32O2
and a molecular weight of 304.47 g/mol. Its IUPAC name is (2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol.
Molecular Properties
| Compound Name | (2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol |
| PubChem CID | 67580271 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol |
| SMILES | CC(C)=CCC/C(C)=C/CO.Cc1ccc(C(C)C)c(O)c1 |
| InChI | InChI=1S/C10H14O.C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11;1-9(2)5-4-6-10(3)7-8-11/h4-7,11H,1-3H3;5,7,11H,4,6,8H2,1-3H3/b;10-7+ |
| InChIKey | XZKFWUXRPURAFB-FXRCEOBJSA-N |
| XLogP | 5.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol?
The IUPAC name of (2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol (CID 67580271) is (2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol.
What is the SMILES notation for (2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol?
The canonical SMILES for (2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol is CC(C)=CCC/C(C)=C/CO.Cc1ccc(C(C)C)c(O)c1.
What is the InChIKey of (2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol?
The InChIKey is XZKFWUXRPURAFB-FXRCEOBJSA-N. The full InChI is InChI=1S/C10H14O.C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11;1-9(2)5-4-6-10(3)7-8-11/h4-7,11H,1-3H3;5,7,11H,4,6,8H2,1-3H3/b;10-7+.
What are the key properties of (2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol?
(2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol has a molecular weight of 304.47 g/mol, XLogP of 5.50, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3,7-dimethylocta-2,6-dien-1-ol;5-methyl-2-propan-2-ylphenol is sourced from PubChem (CID 67580271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).