C24H29F4NO4S — CID 67580352
methyl 4-[4-[7,7,7-trifluoro-1-[(4-fluorophenyl)sulfonylamino]heptyl]phenyl]butanoate (PubChem CID 67580352) has the molecular formula C24H29F4NO4S and a molecular weight of 503.56 g/mol. Its IUPAC name is methyl 4-[4-[7,7,7-trifluoro-1-[(4-fluorophenyl)sulfonylamino]heptyl]phenyl]butanoate.
| Compound Name | methyl 4-[4-[7,7,7-trifluoro-1-[(4-fluorophenyl)sulfonylamino]heptyl]phenyl]butanoate |
|---|---|
| PubChem CID | 67580352 |
| Molecular Formula | C24H29F4NO4S |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | methyl 4-[4-[7,7,7-trifluoro-1-[(4-fluorophenyl)sulfonylamino]heptyl]phenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc(C(CCCCCC(F)(F)F)NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H29F4NO4S/c1-33-23(30)8-5-6-18-9-11-19(12-10-18)22(7-3-2-4-17-24(26,27)28)29-34(31,32)21-15-13-20(25)14-16-21/h9-16,22,29H,2-8,17H2,1H3 |
| InChIKey | LILRFLUZUHIQCQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|