C22H32N6 — CID 67580499
1-N,4-N-bis[1-(dimethylamino)propyl]benzo[g]phthalazine-1,4-diamine (PubChem CID 67580499) has the molecular formula C22H32N6 and a molecular weight of 380.54 g/mol. Its IUPAC name is 1-N,4-N-bis[1-(dimethylamino)propyl]benzo[g]phthalazine-1,4-diamine.
| Compound Name | 1-N,4-N-bis[1-(dimethylamino)propyl]benzo[g]phthalazine-1,4-diamine |
|---|---|
| PubChem CID | 67580499 |
| Molecular Formula | C22H32N6 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 1-N,4-N-bis[1-(dimethylamino)propyl]benzo[g]phthalazine-1,4-diamine |
| SMILES | CCC(Nc1nnc(NC(CC)N(C)C)c2cc3ccccc3cc12)N(C)C |
| InChI | InChI=1S/C22H32N6/c1-7-19(27(3)4)23-21-17-13-15-11-9-10-12-16(15)14-18(17)22(26-25-21)24-20(8-2)28(5)6/h9-14,19-20H,7-8H2,1-6H3,(H,23,25)(H,24,26) |
| InChIKey | VFMRSPOKMALHJG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|