C10H21N3O — CID 67580612
1-(1-ethylpyrrolidin-3-yl)-1,3,3-trimethylurea (PubChem CID 67580612) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 1-(1-ethylpyrrolidin-3-yl)-1,3,3-trimethylurea.
| Compound Name | 1-(1-ethylpyrrolidin-3-yl)-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 67580612 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 1-(1-ethylpyrrolidin-3-yl)-1,3,3-trimethylurea |
| SMILES | CCN1CCC(N(C)C(=O)N(C)C)C1 |
| InChI | InChI=1S/C10H21N3O/c1-5-13-7-6-9(8-13)12(4)10(14)11(2)3/h9H,5-8H2,1-4H3 |
| InChIKey | IIGYKZBMBWRWGH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |