C23H26FN3O3S — CID 67580969
2-[2-butoxy-6-(4-fluorophenyl)-3-(methylaminomethyl)-4-pyridinyl]benzenesulfonamide (PubChem CID 67580969) has the molecular formula C23H26FN3O3S and a molecular weight of 443.54 g/mol. Its IUPAC name is 2-[2-butoxy-6-(4-fluorophenyl)-3-(methylaminomethyl)-4-pyridinyl]benzenesulfonamide.
| Compound Name | 2-[2-butoxy-6-(4-fluorophenyl)-3-(methylaminomethyl)-4-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 67580969 |
| Molecular Formula | C23H26FN3O3S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-[2-butoxy-6-(4-fluorophenyl)-3-(methylaminomethyl)-4-pyridinyl]benzenesulfonamide |
| SMILES | CCCCOc1nc(-c2ccc(F)cc2)cc(-c2ccccc2S(N)(=O)=O)c1CNC |
| InChI | InChI=1S/C23H26FN3O3S/c1-3-4-13-30-23-20(15-26-2)19(18-7-5-6-8-22(18)31(25,28)29)14-21(27-23)16-9-11-17(24)12-10-16/h5-12,14,26H,3-4,13,15H2,1-2H3,(H2,25,28,29) |
| InChIKey | SFYFCZSNKVREFR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|