C16H30O6S — CID 67582522
methyl 9-[(2S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylnonanoate (PubChem CID 67582522) has the molecular formula C16H30O6S and a molecular weight of 350.48 g/mol. Its IUPAC name is methyl 9-[(2S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylnonanoate.
| Compound Name | methyl 9-[(2S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylnonanoate |
|---|---|
| PubChem CID | 67582522 |
| Molecular Formula | C16H30O6S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | methyl 9-[(2S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylnonanoate |
| SMILES | COC(=O)CCCCCCCCS[C@H]1C[C@@H](O)[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C16H30O6S/c1-21-14(19)8-6-4-2-3-5-7-9-23-15-10-12(18)16(20)13(11-17)22-15/h12-13,15-18,20H,2-11H2,1H3/t12-,13-,15+,16+/m1/s1 |
| InChIKey | NCDYFIOZBWJYMZ-VDERGJSUSA-N |
| XLogP | 1.45 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|