C24H25F3N4O6S2 — CID 67583055
5-[[3-[(7-methoxynaphthalen-2-yl)sulfonylmethylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-3-carboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 67583055) has the molecular formula C24H25F3N4O6S2 and a molecular weight of 586.61 g/mol. Its IUPAC name is 5-[[3-[(7-methoxynaphthalen-2-yl)sulfonylmethylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-3-carboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[[3-[(7-methoxynaphthalen-2-yl)sulfonylmethylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-3-carboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67583055 |
| Molecular Formula | C24H25F3N4O6S2 |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 586.12 |
| IUPAC Name | 5-[[3-[(7-methoxynaphthalen-2-yl)sulfonylmethylamino]-2-oxopyrrolidin-1-yl]methyl]thiophene-3-carboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1csc(CN2CCC(NCS(=O)(=O)c3ccc4ccc(OC)cc4c3)C2=O)c1 |
| InChI | InChI=1S/C22H24N4O4S2.C2HF3O2/c1-30-17-4-2-14-3-5-19(10-15(14)8-17)32(28,29)13-25-20-6-7-26(22(20)27)11-18-9-16(12-31-18)21(23)24;3-2(4,5)1(6)7/h2-5,8-10,12,20,25H,6-7,11,13H2,1H3,(H3,23,24);(H,6,7) |
| InChIKey | SQDLKJDHOBOTPS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|