C12H17N3O5 — CID 67583186
4,4-dimethylpiperidine-2,6-dione;1-methyl-1,3-diazinane-2,4,6-trione (PubChem CID 67583186) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 4,4-dimethylpiperidine-2,6-dione;1-methyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 4,4-dimethylpiperidine-2,6-dione;1-methyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 67583186 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4,4-dimethylpiperidine-2,6-dione;1-methyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC1(C)CC(=O)NC(=O)C1.CN1C(=O)CC(=O)NC1=O |
| InChI | InChI=1S/C7H11NO2.C5H6N2O3/c1-7(2)3-5(9)8-6(10)4-7;1-7-4(9)2-3(8)6-5(7)10/h3-4H2,1-2H3,(H,8,9,10);2H2,1H3,(H,6,8,10) |
| InChIKey | BSJIJVYUGFMEBI-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|