C24H28F3N5O4 — CID 67583331
2-[amino(3,3-dimethylbutanoyl)amino]-3-[2-[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]phenyl]propanoic acid (PubChem CID 67583331) has the molecular formula C24H28F3N5O4 and a molecular weight of 507.51 g/mol. Its IUPAC name is 2-[amino(3,3-dimethylbutanoyl)amino]-3-[2-[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]phenyl]propanoic acid.
| Compound Name | 2-[amino(3,3-dimethylbutanoyl)amino]-3-[2-[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67583331 |
| Molecular Formula | C24H28F3N5O4 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 2-[amino(3,3-dimethylbutanoyl)amino]-3-[2-[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]phenyl]propanoic acid |
| SMILES | CC(C)(C)CC(=O)N(N)C(Cc1ccccc1C(=O)c1cc(/N=C/NN)cc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C24H28F3N5O4/c1-23(2,3)12-20(33)32(29)19(22(35)36)10-14-6-4-5-7-18(14)21(34)15-8-16(24(25,26)27)11-17(9-15)30-13-31-28/h4-9,11,13,19H,10,12,28-29H2,1-3H3,(H,30,31)(H,35,36) |
| InChIKey | PMZHBFHYEYIGCG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 151.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|