C24H38O11S — CID 67583433
methyl 9-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylnonanoate (PubChem CID 67583433) has the molecular formula C24H38O11S and a molecular weight of 534.60 g/mol. Its IUPAC name is methyl 9-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylnonanoate.
| Compound Name | methyl 9-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylnonanoate |
|---|---|
| PubChem CID | 67583433 |
| Molecular Formula | C24H38O11S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | methyl 9-[(2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylnonanoate |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@@H](O1)SCCCCCCCCC(=O)OC)OC(=O)C)OC(=O)C)OC(=O)C |
| InChI | InChI=1S/C24H38O11S/c1-15(25)31-14-19-21(32-16(2)26)22(33-17(3)27)23(34-18(4)28)24(35-19)36-13-11-9-7-6-8-10-12-20(29)30-5/h19,21-24H,6-14H2,1-5H3/t19-,21-,22+,23+,24+/m1/s1 |
| InChIKey | DKZROOFHDRFDJN-AZKGINQHSA-N |
| XLogP | 3.00 |
| TPSA | 166.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | 742 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|