C15H28O6S — CID 67583442
methyl 9-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanylnonanoate (PubChem CID 67583442) has the molecular formula C15H28O6S and a molecular weight of 336.45 g/mol. Its IUPAC name is methyl 9-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanylnonanoate.
| Compound Name | methyl 9-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanylnonanoate |
|---|---|
| PubChem CID | 67583442 |
| Molecular Formula | C15H28O6S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | methyl 9-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanylnonanoate |
| SMILES | COC(=O)CCCCCCCCS[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H28O6S/c1-20-12(17)8-6-4-2-3-5-7-9-22-15-14(19)13(18)11(16)10-21-15/h11,13-16,18-19H,2-10H2,1H3/t11-,13+,14-,15+/m1/s1 |
| InChIKey | BKKKPIMEVUWDHD-BEAPCOKYSA-N |
| XLogP | 1.06 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|