About 2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile
2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile (PubChem CID 67584119) has the molecular formula C23H20N2O2
and a molecular weight of 356.43 g/mol. Its IUPAC name is 2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile.
Molecular Properties
| Compound Name | 2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile |
| PubChem CID | 67584119 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile |
| SMILES | CCC#N.N#CC(C1=CCc2ccc(O)cc21)C1=CCc2ccc(O)cc21 |
| InChI | InChI=1S/C20H15NO2.C3H5N/c21-11-20(16-7-3-12-1-5-14(22)9-18(12)16)17-8-4-13-2-6-15(23)10-19(13)17;1-2-3-4/h1-2,5-10,20,22-23H,3-4H2;2H2,1H3 |
| InChIKey | DJRFQQACJSSTKT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile?
The IUPAC name of 2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile (CID 67584119) is 2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile.
What is the SMILES notation for 2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile?
The canonical SMILES for 2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile is CCC#N.N#CC(C1=CCc2ccc(O)cc21)C1=CCc2ccc(O)cc21.
What is the InChIKey of 2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile?
The InChIKey is DJRFQQACJSSTKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO2.C3H5N/c21-11-20(16-7-3-12-1-5-14(22)9-18(12)16)17-8-4-13-2-6-15(23)10-19(13)17;1-2-3-4/h1-2,5-10,20,22-23H,3-4H2;2H2,1H3.
What are the key properties of 2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile?
2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile has a molecular weight of 356.43 g/mol, XLogP of 4.74, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(6-hydroxy-3H-inden-1-yl)acetonitrile;propanenitrile is sourced from PubChem (CID 67584119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).