About 2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid
2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid (PubChem CID 67584126) has the molecular formula C11H15NO5
and a molecular weight of 241.24 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid.
Molecular Properties
| Compound Name | 2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid |
| PubChem CID | 67584126 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.O=C(O)C=CN1CCCC1=O |
| InChI | InChI=1S/C7H9NO3.C4H6O2/c9-6-2-1-4-8(6)5-3-7(10)11;1-3(2)4(5)6/h3,5H,1-2,4H2,(H,10,11);1H2,2H3,(H,5,6) |
| InChIKey | MNZGVSKCOCOUII-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid?
The IUPAC name of 2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid (CID 67584126) is 2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid.
What is the SMILES notation for 2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid?
The canonical SMILES for 2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid is C=C(C)C(=O)O.O=C(O)C=CN1CCCC1=O.
What is the InChIKey of 2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid?
The InChIKey is MNZGVSKCOCOUII-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3.C4H6O2/c9-6-2-1-4-8(6)5-3-7(10)11;1-3(2)4(5)6/h3,5H,1-2,4H2,(H,10,11);1H2,2H3,(H,5,6).
What are the key properties of 2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid?
2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid has a molecular weight of 241.24 g/mol, XLogP of 0.85, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoic acid;3-(2-oxopyrrolidin-1-yl)prop-2-enoic acid is sourced from PubChem (CID 67584126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).