C24H33N3O3S — CID 67584556
7-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-N,N,2,4-tetramethyl-2,3-dihydro-1-benzofuran-5-sulfonamide (PubChem CID 67584556) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is 7-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-N,N,2,4-tetramethyl-2,3-dihydro-1-benzofuran-5-sulfonamide.
| Compound Name | 7-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-N,N,2,4-tetramethyl-2,3-dihydro-1-benzofuran-5-sulfonamide |
|---|---|
| PubChem CID | 67584556 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 7-[[(2S,3S)-1-amino-2-phenylpiperidin-3-yl]methyl]-N,N,2,4-tetramethyl-2,3-dihydro-1-benzofuran-5-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)N(C)C)cc(C[C@@H]2CCCN(N)[C@@H]2c2ccccc2)c2c1CC(C)O2 |
| InChI | InChI=1S/C24H33N3O3S/c1-16-13-21-17(2)22(31(28,29)26(3)4)15-20(24(21)30-16)14-19-11-8-12-27(25)23(19)18-9-6-5-7-10-18/h5-7,9-10,15-16,19,23H,8,11-14,25H2,1-4H3/t16?,19-,23+/m0/s1 |
| InChIKey | MGILLRBSQAWZGC-GAKOPZHISA-N |
| XLogP | 3.44 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|