C21H23F3N2OS — CID 67584637
(2S,3S)-2-phenyl-3-[[5-(trifluoromethylsulfanyl)-2,3-dihydro-1-benzofuran-7-yl]methyl]piperidin-1-amine (PubChem CID 67584637) has the molecular formula C21H23F3N2OS and a molecular weight of 408.49 g/mol. Its IUPAC name is (2S,3S)-2-phenyl-3-[[5-(trifluoromethylsulfanyl)-2,3-dihydro-1-benzofuran-7-yl]methyl]piperidin-1-amine.
| Compound Name | (2S,3S)-2-phenyl-3-[[5-(trifluoromethylsulfanyl)-2,3-dihydro-1-benzofuran-7-yl]methyl]piperidin-1-amine |
|---|---|
| PubChem CID | 67584637 |
| Molecular Formula | C21H23F3N2OS |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (2S,3S)-2-phenyl-3-[[5-(trifluoromethylsulfanyl)-2,3-dihydro-1-benzofuran-7-yl]methyl]piperidin-1-amine |
| SMILES | NN1CCC[C@@H](Cc2cc(SC(F)(F)F)cc3c2OCC3)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H23F3N2OS/c22-21(23,24)28-18-12-16-8-10-27-20(16)17(13-18)11-15-7-4-9-26(25)19(15)14-5-2-1-3-6-14/h1-3,5-6,12-13,15,19H,4,7-11,25H2/t15-,19+/m0/s1 |
| InChIKey | QNRRVBSZYSTONA-HNAYVOBHSA-N |
| XLogP | 5.10 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|