C21H25FN2O — CID 67584982
(2S,3S)-3-[(5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine (PubChem CID 67584982) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is (2S,3S)-3-[(5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine.
| Compound Name | (2S,3S)-3-[(5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine |
|---|---|
| PubChem CID | 67584982 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (2S,3S)-3-[(5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine |
| SMILES | CC1Cc2cc(F)cc(C[C@@H]3CCCN(N)[C@@H]3c3ccccc3)c2O1 |
| InChI | InChI=1S/C21H25FN2O/c1-14-10-17-12-19(22)13-18(21(17)25-14)11-16-8-5-9-24(23)20(16)15-6-3-2-4-7-15/h2-4,6-7,12-14,16,20H,5,8-11,23H2,1H3/t14?,16-,20+/m0/s1 |
| InChIKey | VMVDTFHNRUMGRU-PNKJRWENSA-N |
| XLogP | 4.02 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|