C40H48O2 — CID 67585796
4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid;1,1,4,4-tetramethyl-2-prop-1-en-2-yl-2,3-dihydronaphthalene (PubChem CID 67585796) has the molecular formula C40H48O2 and a molecular weight of 560.82 g/mol. Its IUPAC name is 4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid;1,1,4,4-tetramethyl-2-prop-1-en-2-yl-2,3-dihydronaphthalene.
| Compound Name | 4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid;1,1,4,4-tetramethyl-2-prop-1-en-2-yl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 67585796 |
| Molecular Formula | C40H48O2 |
| Molecular Weight | 560.82 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | 4-[2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethynyl]benzoic acid;1,1,4,4-tetramethyl-2-prop-1-en-2-yl-2,3-dihydronaphthalene |
| SMILES | C=C(C)C1CC(C)(C)c2ccccc2C1(C)C.CC1(C)CCC(C)(C)c2cc(C#Cc3ccc(C(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C23H24O2.C17H24/c1-22(2)13-14-23(3,4)20-15-17(9-12-19(20)22)6-5-16-7-10-18(11-8-16)21(24)25;1-12(2)15-11-16(3,4)13-9-7-8-10-14(13)17(15,5)6/h7-12,15H,13-14H2,1-4H3,(H,24,25);7-10,15H,1,11H2,2-6H3 |
| InChIKey | VKMLALFMANGUCM-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.82 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|