C23H31ClN2O2 — CID 67586192
(2S,3S)-3-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine;hydrochloride (PubChem CID 67586192) has the molecular formula C23H31ClN2O2 and a molecular weight of 402.97 g/mol. Its IUPAC name is (2S,3S)-3-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine;hydrochloride.
| Compound Name | (2S,3S)-3-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine;hydrochloride |
|---|---|
| PubChem CID | 67586192 |
| Molecular Formula | C23H31ClN2O2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (2S,3S)-3-[(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine;hydrochloride |
| SMILES | CCOc1cc2c(c(C[C@@H]3CCCN(N)[C@@H]3c3ccccc3)c1)OC(C)C2.Cl |
| InChI | InChI=1S/C23H30N2O2.ClH/c1-3-26-21-14-19-12-16(2)27-23(19)20(15-21)13-18-10-7-11-25(24)22(18)17-8-5-4-6-9-17;/h4-6,8-9,14-16,18,22H,3,7,10-13,24H2,1-2H3;1H/t16?,18-,22+;/m0./s1 |
| InChIKey | JJRXMFQYBSBXFW-KXOBPSOWSA-N |
| XLogP | 4.70 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|