C21H27ClN2O2S — CID 67586200
(2S,3S)-3-[(5-methylsulfinyl-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine;hydrochloride (PubChem CID 67586200) has the molecular formula C21H27ClN2O2S and a molecular weight of 406.98 g/mol. Its IUPAC name is (2S,3S)-3-[(5-methylsulfinyl-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine;hydrochloride.
| Compound Name | (2S,3S)-3-[(5-methylsulfinyl-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine;hydrochloride |
|---|---|
| PubChem CID | 67586200 |
| Molecular Formula | C21H27ClN2O2S |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (2S,3S)-3-[(5-methylsulfinyl-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-phenylpiperidin-1-amine;hydrochloride |
| SMILES | CS(=O)c1cc2c(c(C[C@@H]3CCCN(N)[C@@H]3c3ccccc3)c1)OCC2.Cl |
| InChI | InChI=1S/C21H26N2O2S.ClH/c1-26(24)19-13-17-9-11-25-21(17)18(14-19)12-16-8-5-10-23(22)20(16)15-6-3-2-4-7-15;/h2-4,6-7,13-14,16,20H,5,8-12,22H2,1H3;1H/t16-,20+,26?;/m0./s1 |
| InChIKey | AQGBGJAJBCRJFH-LCAYLKTKSA-N |
| XLogP | 3.65 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|