About 2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride
2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride (PubChem CID 67586536) has the molecular formula C10H17ClINO
and a molecular weight of 329.61 g/mol. Its IUPAC name is 2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride |
| PubChem CID | 67586536 |
| Molecular Formula | C10H17ClINO |
| Molecular Weight | 329.61 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride |
| SMILES | CN(C)CCOC1(I)C=CC=CC1.Cl |
| InChI | InChI=1S/C10H16INO.ClH/c1-12(2)8-9-13-10(11)6-4-3-5-7-10;/h3-6H,7-9H2,1-2H3;1H |
| InChIKey | DHZBMFYVEZQXJA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride?
The IUPAC name of 2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride (CID 67586536) is 2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride.
What is the SMILES notation for 2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride?
The canonical SMILES for 2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride is CN(C)CCOC1(I)C=CC=CC1.Cl.
What is the InChIKey of 2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride?
The InChIKey is DHZBMFYVEZQXJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16INO.ClH/c1-12(2)8-9-13-10(11)6-4-3-5-7-10;/h3-6H,7-9H2,1-2H3;1H.
What are the key properties of 2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride?
2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride has a molecular weight of 329.61 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-iodocyclohexa-2,4-dien-1-yl)oxy-N,N-dimethylethanamine;hydrochloride is sourced from PubChem (CID 67586536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).