About 4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline
4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline (PubChem CID 67586881) has the molecular formula C18H21N7
and a molecular weight of 335.42 g/mol. Its IUPAC name is 4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline.
Molecular Properties
| Compound Name | 4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline |
| PubChem CID | 67586881 |
| Molecular Formula | C18H21N7 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline |
| SMILES | NNc1ccc(N(c2ccc(NN)cc2)c2ccc(NN)cc2)cc1 |
| InChI | InChI=1S/C18H21N7/c19-22-13-1-7-16(8-2-13)25(17-9-3-14(23-20)4-10-17)18-11-5-15(24-21)6-12-18/h1-12,22-24H,19-21H2 |
| InChIKey | DHXHQYBIUUPGAA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 117.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline?
The IUPAC name of 4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline (CID 67586881) is 4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline.
What is the SMILES notation for 4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline?
The canonical SMILES for 4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline is NNc1ccc(N(c2ccc(NN)cc2)c2ccc(NN)cc2)cc1.
What is the InChIKey of 4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline?
The InChIKey is DHXHQYBIUUPGAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N7/c19-22-13-1-7-16(8-2-13)25(17-9-3-14(23-20)4-10-17)18-11-5-15(24-21)6-12-18/h1-12,22-24H,19-21H2.
What are the key properties of 4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline?
4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline has a molecular weight of 335.42 g/mol, XLogP of 3.01, 6 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydrazinyl-N,N-bis(4-hydrazinylphenyl)aniline is sourced from PubChem (CID 67586881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).