About 8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine
8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine (PubChem CID 67587660) has the molecular formula C14H14F2N6
and a molecular weight of 304.30 g/mol. Its IUPAC name is 8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine.
Molecular Properties
| Compound Name | 8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine |
| PubChem CID | 67587660 |
| Molecular Formula | C14H14F2N6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine |
| SMILES | CC(C)Nc1ncc2[nH]c(Nc3ccc(F)cc3F)nc2n1 |
| InChI | InChI=1S/C14H14F2N6/c1-7(2)18-13-17-6-11-12(21-13)22-14(20-11)19-10-4-3-8(15)5-9(10)16/h3-7H,1-2H3,(H3,17,18,19,20,21,22) |
| InChIKey | DNPWAWHBZMFGPV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine?
The IUPAC name of 8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine (CID 67587660) is 8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine.
What is the SMILES notation for 8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine?
The canonical SMILES for 8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine is CC(C)Nc1ncc2[nH]c(Nc3ccc(F)cc3F)nc2n1.
What is the InChIKey of 8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine?
The InChIKey is DNPWAWHBZMFGPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2N6/c1-7(2)18-13-17-6-11-12(21-13)22-14(20-11)19-10-4-3-8(15)5-9(10)16/h3-7H,1-2H3,(H3,17,18,19,20,21,22).
What are the key properties of 8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine?
8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine has a molecular weight of 304.30 g/mol, XLogP of 3.19, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-N-(2,4-difluorophenyl)-2-N-propan-2-yl-7H-purine-2,8-diamine is sourced from PubChem (CID 67587660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).