About 1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol
1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol (PubChem CID 67587678) has the molecular formula C13H10N4O2S2
and a molecular weight of 318.38 g/mol. Its IUPAC name is 1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol.
Molecular Properties
| Compound Name | 1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol |
| PubChem CID | 67587678 |
| Molecular Formula | C13H10N4O2S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol |
| SMILES | O=[N+]([O-])c1cnc(-c2nc(S)cn2Cc2ccccc2)s1 |
| InChI | InChI=1S/C13H10N4O2S2/c18-17(19)11-6-14-13(21-11)12-15-10(20)8-16(12)7-9-4-2-1-3-5-9/h1-6,8,20H,7H2 |
| InChIKey | MKQLNQRSOJTXEV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol?
The IUPAC name of 1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol (CID 67587678) is 1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol.
What is the SMILES notation for 1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol?
The canonical SMILES for 1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol is O=[N+]([O-])c1cnc(-c2nc(S)cn2Cc2ccccc2)s1.
What is the InChIKey of 1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol?
The InChIKey is MKQLNQRSOJTXEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O2S2/c18-17(19)11-6-14-13(21-11)12-15-10(20)8-16(12)7-9-4-2-1-3-5-9/h1-6,8,20H,7H2.
What are the key properties of 1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol?
1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol has a molecular weight of 318.38 g/mol, XLogP of 3.25, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-(5-nitro-1,3-thiazol-2-yl)imidazole-4-thiol is sourced from PubChem (CID 67587678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).