C22H33BN4O3Si — CID 67587750
trimethyl-[2-[[3-(1H-pyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane (PubChem CID 67587750) has the molecular formula C22H33BN4O3Si and a molecular weight of 440.43 g/mol. Its IUPAC name is trimethyl-[2-[[3-(1H-pyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[3-(1H-pyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 67587750 |
| Molecular Formula | C22H33BN4O3Si |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | trimethyl-[2-[[3-(1H-pyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl]silane |
| SMILES | CC1(C)OB(c2cnc3c(c2)c(-c2cn[nH]c2)cn3COCC[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C22H33BN4O3Si/c1-21(2)22(3,4)30-23(29-21)17-10-18-19(16-11-25-26-12-16)14-27(20(18)24-13-17)15-28-8-9-31(5,6)7/h10-14H,8-9,15H2,1-7H3,(H,25,26) |
| InChIKey | OLTZAVDJALFTIC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|