C24H31N5OSSi — CID 67587752
N,N-dimethyl-3-[3-(1H-pyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]sulfanylaniline (PubChem CID 67587752) has the molecular formula C24H31N5OSSi and a molecular weight of 465.70 g/mol. Its IUPAC name is N,N-dimethyl-3-[3-(1H-pyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]sulfanylaniline.
| Compound Name | N,N-dimethyl-3-[3-(1H-pyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]sulfanylaniline |
|---|---|
| PubChem CID | 67587752 |
| Molecular Formula | C24H31N5OSSi |
| Molecular Weight | 465.70 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | N,N-dimethyl-3-[3-(1H-pyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]sulfanylaniline |
| SMILES | CN(C)c1cccc(Sc2cnc3c(c2)c(-c2cn[nH]c2)cn3COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C24H31N5OSSi/c1-28(2)19-7-6-8-20(11-19)31-21-12-22-23(18-13-26-27-14-18)16-29(24(22)25-15-21)17-30-9-10-32(3,4)5/h6-8,11-16H,9-10,17H2,1-5H3,(H,26,27) |
| InChIKey | ZVUQPNMAQFXFMF-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.70 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|