C23H32ClN3O4S — CID 67587922
[(7R,10aS)-2-chloro-5,5-dioxo-8,9,10,10a-tetrahydro-7H-pyrido[1,2-b][1,2]benzothiazol-7-yl]methyl 4-(2-methylpyrrolidin-1-yl)piperidine-1-carboxylate (PubChem CID 67587922) has the molecular formula C23H32ClN3O4S and a molecular weight of 482.05 g/mol. Its IUPAC name is [(7R,10aS)-2-chloro-5,5-dioxo-8,9,10,10a-tetrahydro-7H-pyrido[1,2-b][1,2]benzothiazol-7-yl]methyl 4-(2-methylpyrrolidin-1-yl)piperidine-1-carboxylate.
| Compound Name | [(7R,10aS)-2-chloro-5,5-dioxo-8,9,10,10a-tetrahydro-7H-pyrido[1,2-b][1,2]benzothiazol-7-yl]methyl 4-(2-methylpyrrolidin-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67587922 |
| Molecular Formula | C23H32ClN3O4S |
| Molecular Weight | 482.05 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | [(7R,10aS)-2-chloro-5,5-dioxo-8,9,10,10a-tetrahydro-7H-pyrido[1,2-b][1,2]benzothiazol-7-yl]methyl 4-(2-methylpyrrolidin-1-yl)piperidine-1-carboxylate |
| SMILES | CC1CCCN1C1CCN(C(=O)OC[C@H]2CCC[C@H]3c4cc(Cl)ccc4S(=O)(=O)N23)CC1 |
| InChI | InChI=1S/C23H32ClN3O4S/c1-16-4-3-11-26(16)18-9-12-25(13-10-18)23(28)31-15-19-5-2-6-21-20-14-17(24)7-8-22(20)32(29,30)27(19)21/h7-8,14,16,18-19,21H,2-6,9-13,15H2,1H3/t16?,19-,21+/m1/s1 |
| InChIKey | SLSWTSLPMVEAGU-MDFYDDKXSA-N |
| XLogP | 4.02 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.05 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |