C11H19NO5P+ — CID 67588360
[(3S,4aR,6S,8aR)-3-carboxy-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-yl]methoxy-hydroxy-oxophosphanium (PubChem CID 67588360) has the molecular formula C11H19NO5P+ and a molecular weight of 276.25 g/mol. Its IUPAC name is [(3S,4aR,6S,8aR)-3-carboxy-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-yl]methoxy-hydroxy-oxophosphanium.
| Compound Name | [(3S,4aR,6S,8aR)-3-carboxy-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-yl]methoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 67588360 |
| Molecular Formula | C11H19NO5P+ |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | [(3S,4aR,6S,8aR)-3-carboxy-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-6-yl]methoxy-hydroxy-oxophosphanium |
| SMILES | O=C(O)[C@@H]1C[C@H]2C[C@@H](CO[P+](=O)O)CC[C@H]2CN1 |
| InChI | InChI=1S/C11H18NO5P/c13-11(14)10-4-9-3-7(6-17-18(15)16)1-2-8(9)5-12-10/h7-10,12H,1-6H2,(H-,13,14,15,16)/p+1/t7-,8-,9+,10-/m0/s1 |
| InChIKey | HCLWYDYWUQCKLH-QEYWKRMJSA-O |
| XLogP | 1.13 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|