About 5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine
5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine (PubChem CID 67589667) has the molecular formula C8H17N3
and a molecular weight of 155.25 g/mol. Its IUPAC name is 5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine.
Molecular Properties
| Compound Name | 5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine |
| PubChem CID | 67589667 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine |
| SMILES | CNC1=C(CN)CN(C)CC1 |
| InChI | InChI=1S/C8H17N3/c1-10-8-3-4-11(2)6-7(8)5-9/h10H,3-6,9H2,1-2H3 |
| InChIKey | ACVNNRLSVMAYFV-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine?
The IUPAC name of 5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine (CID 67589667) is 5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine.
What is the SMILES notation for 5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine?
The canonical SMILES for 5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine is CNC1=C(CN)CN(C)CC1.
What is the InChIKey of 5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine?
The InChIKey is ACVNNRLSVMAYFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3/c1-10-8-3-4-11(2)6-7(8)5-9/h10H,3-6,9H2,1-2H3.
What are the key properties of 5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine?
5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine has a molecular weight of 155.25 g/mol, XLogP of -0.25, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-N,1-dimethyl-3,6-dihydro-2H-pyridin-4-amine is sourced from PubChem (CID 67589667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).