C18H26N6O4 — CID 67589804
5-[1-[2,4-dioxo-1-(propylamino)pyrimidin-5-yl]but-3-enyl]-1-(propylamino)pyrimidine-2,4-dione (PubChem CID 67589804) has the molecular formula C18H26N6O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 5-[1-[2,4-dioxo-1-(propylamino)pyrimidin-5-yl]but-3-enyl]-1-(propylamino)pyrimidine-2,4-dione.
| Compound Name | 5-[1-[2,4-dioxo-1-(propylamino)pyrimidin-5-yl]but-3-enyl]-1-(propylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67589804 |
| Molecular Formula | C18H26N6O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 5-[1-[2,4-dioxo-1-(propylamino)pyrimidin-5-yl]but-3-enyl]-1-(propylamino)pyrimidine-2,4-dione |
| SMILES | C=CCC(c1cn(NCCC)c(=O)[nH]c1=O)c1cn(NCCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H26N6O4/c1-4-7-12(13-10-23(19-8-5-2)17(27)21-15(13)25)14-11-24(20-9-6-3)18(28)22-16(14)26/h4,10-12,19-20H,1,5-9H2,2-3H3,(H,21,25,27)(H,22,26,28) |
| InChIKey | KZGKTZHOFJCMNO-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|